Type: Neutral
Formula: C16H18ClN3O3
SMILES: |
Clc1ccc(cc1)C(=O)CC(NCCCn1ccnc1)C(O)=O |
InChI: |
InChI=1/C16H18ClN3O3/c17-13-4-2-12(3-5-13)15(21)10-14(16(22)23)19-6-1-8-20-9-7-18-11-20/h2-5,7,9,11,14,19H,1,6,8,10H2,(H,22,23)/t14-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 335.791 g/mol | logS: -2.56312 | SlogP: 2.5088 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0457779 | Sterimol/B1: 2.59402 | Sterimol/B2: 3.08316 | Sterimol/B3: 3.95479 |
Sterimol/B4: 8.37537 | Sterimol/L: 18.4072 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 600.047 | Positive charged surface: 364.011 | Negative charged surface: 236.036 | Volume: 307.875 |
Hydrophobic surface: 447.855 | Hydrophilic surface: 152.192 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |