Type: Neutral
Formula: C18H16ClF3N2O3S
SMILES: |
Clc1ccc(S(=O)(=O)N2CCCC2C(=O)Nc2cc(ccc2)C(F)(F)F)cc1 |
InChI: |
InChI=1/C18H16ClF3N2O3S/c19-13-6-8-15(9-7-13)28(26,27)24-10-2-5-16(24)17(25)23-14-4-1-3-12(11-14)18(20,21)22/h1,3-4,6-9,11,16H,2,5,10H2,(H,23,25)/t16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 432.85 g/mol | logS: -5.63809 | SlogP: 4.4621 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0928998 | Sterimol/B1: 3.35514 | Sterimol/B2: 4.47269 | Sterimol/B3: 4.50888 |
Sterimol/B4: 8.15908 | Sterimol/L: 15.1289 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 614.987 | Positive charged surface: 263.339 | Negative charged surface: 351.647 | Volume: 343.625 |
Hydrophobic surface: 441.864 | Hydrophilic surface: 173.123 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |