Type: Neutral
Formula: C17H21N3O3
SMILES: |
O(C(=O)C1CCCN(C1)C(=O)Nc1c2c([nH]c1)cccc2)CC |
InChI: |
InChI=1/C17H21N3O3/c1-2-23-16(21)12-6-5-9-20(11-12)17(22)19-15-10-18-14-8-4-3-7-13(14)15/h3-4,7-8,10,12,18H,2,5-6,9,11H2,1H3,(H,19,22)/t12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 315.373 g/mol | logS: -2.65634 | SlogP: 2.9749 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0235536 | Sterimol/B1: 2.19915 | Sterimol/B2: 2.69963 | Sterimol/B3: 3.40926 |
Sterimol/B4: 7.94121 | Sterimol/L: 18.2472 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 582.015 | Positive charged surface: 395.912 | Negative charged surface: 180.136 | Volume: 304.5 |
Hydrophobic surface: 449.87 | Hydrophilic surface: 132.145 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |