 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(Nc1cccnc1)CC([NH2+]CCC[NH+](C)C)C(=O)[O-] |
| InChI: | InChI=1/C14H22N4O3/c1-18(2)8-4-7-16-12(14(20)21)9-13(19)17-11-5-3-6-15-10-11/h3,5-6,10,12,16H,4,7-9H2,1-2H3,(H,17,19)(H,20,21)/p+1/t12-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=37.4466 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 295.363 g/mol | logS: -0.28486 | SlogP: -3.3733 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0310542 | Sterimol/B1: 2.31029 | Sterimol/B2: 3.05491 | Sterimol/B3: 3.69281 | |||
| Sterimol/B4: 8.60747 | Sterimol/L: 17.463 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 575.487 | Positive charged surface: 445.61 | Negative charged surface: 129.878 | Volume: 293.25 | |||
| Hydrophobic surface: 376.2 | Hydrophilic surface: 199.287 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 2 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
