Type: Neutral
Formula: C14H18F2N2O3
SMILES: |
Fc1cc(F)ccc1NC(=O)CC(NCCCC)C(O)=O |
InChI: |
InChI=1/C14H18F2N2O3/c1-2-3-6-17-12(14(20)21)8-13(19)18-11-5-4-9(15)7-10(11)16/h4-5,7,12,17H,2-3,6,8H2,1H3,(H,18,19)(H,20,21)/t12-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 300.305 g/mol | logS: -2.86583 | SlogP: 2.1363 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0750012 | Sterimol/B1: 2.16582 | Sterimol/B2: 3.07639 | Sterimol/B3: 4.01033 |
Sterimol/B4: 9.33983 | Sterimol/L: 14.5098 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 548.476 | Positive charged surface: 341.186 | Negative charged surface: 207.29 | Volume: 269.25 |
Hydrophobic surface: 396.809 | Hydrophilic surface: 151.667 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |