Type: Neutral
Formula: C14H17N3O4
SMILES: |
OC(CNC(CC(=O)Nc1ccccc1C#N)C(O)=O)C |
InChI: |
InChI=1/C14H17N3O4/c1-9(18)8-16-12(14(20)21)6-13(19)17-11-5-3-2-4-10(11)7-15/h2-5,9,12,16,18H,6,8H2,1H3,(H,17,19)(H,20,21)/t9-,12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 291.307 g/mol | logS: -1.70727 | SlogP: 0.310484 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0861795 | Sterimol/B1: 2.25525 | Sterimol/B2: 3.80752 | Sterimol/B3: 4.17977 |
Sterimol/B4: 8.1426 | Sterimol/L: 14.428 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 539.189 | Positive charged surface: 333.816 | Negative charged surface: 205.373 | Volume: 271.125 |
Hydrophobic surface: 288.993 | Hydrophilic surface: 250.196 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |