 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1cc(NC(=O)CC(NCCCNC)C(O)=O)ccc1C |
| InChI: | InChI=1/C15H22ClN3O3/c1-10-4-5-11(8-12(10)16)19-14(20)9-13(15(21)22)18-7-3-6-17-2/h4-5,8,13,17-18H,3,6-7,9H2,1-2H3,(H,19,20)(H,21,22)/t13-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=55.3206 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 327.812 g/mol | logS: -2.09514 | SlogP: 1.62932 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0571367 | Sterimol/B1: 2.8837 | Sterimol/B2: 3.02854 | Sterimol/B3: 4.5781 | |||
| Sterimol/B4: 9.33982 | Sterimol/L: 16.7049 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 617.979 | Positive charged surface: 416.278 | Negative charged surface: 201.701 | Volume: 309.25 | |||
| Hydrophobic surface: 463.401 | Hydrophilic surface: 154.578 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
