Type: Neutral
Formula: C14H21N3O3
SMILES: |
OC(=O)C(NCCN)CC(=O)Nc1cc(C)c(cc1)C |
InChI: |
InChI=1/C14H21N3O3/c1-9-3-4-11(7-10(9)2)17-13(18)8-12(14(19)20)16-6-5-15/h3-4,7,12,16H,5-6,8,15H2,1-2H3,(H,17,18)(H,19,20)/t12-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 279.34 g/mol | logS: -1.87087 | SlogP: 0.63354 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0743574 | Sterimol/B1: 2.90043 | Sterimol/B2: 3.98138 | Sterimol/B3: 4.82064 |
Sterimol/B4: 6.43188 | Sterimol/L: 14.543 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 556.15 | Positive charged surface: 385.193 | Negative charged surface: 170.957 | Volume: 274.875 |
Hydrophobic surface: 358.813 | Hydrophilic surface: 197.337 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |