Type: Neutral
Formula: C15H22N2O4
SMILES: |
OC(=O)C(NCCCO)CC(=O)Nc1ccc(cc1C)C |
InChI: |
InChI=1/C15H22N2O4/c1-10-4-5-12(11(2)8-10)17-14(19)9-13(15(20)21)16-6-3-7-18/h4-5,8,13,16,18H,3,6-7,9H2,1-2H3,(H,17,19)(H,20,21)/t13-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 294.351 g/mol | logS: -1.86529 | SlogP: 1.05724 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0313604 | Sterimol/B1: 2.55324 | Sterimol/B2: 2.85719 | Sterimol/B3: 3.29601 |
Sterimol/B4: 8.4715 | Sterimol/L: 15.2321 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 583.787 | Positive charged surface: 396.337 | Negative charged surface: 187.45 | Volume: 288.375 |
Hydrophobic surface: 407.504 | Hydrophilic surface: 176.283 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |