Type: Neutral
Formula: C15H22N2O5
SMILES: |
O(CCNC(CC(=O)Nc1cc(ccc1)C)C(O)=O)CCO |
InChI: |
InChI=1/C15H22N2O5/c1-11-3-2-4-12(9-11)17-14(19)10-13(15(20)21)16-5-7-22-8-6-18/h2-4,9,13,16,18H,5-8,10H2,1H3,(H,17,19)(H,20,21)/t13-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 310.35 g/mol | logS: -1.64569 | SlogP: 0.37532 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.097699 | Sterimol/B1: 2.39624 | Sterimol/B2: 2.93322 | Sterimol/B3: 5.56031 |
Sterimol/B4: 8.12677 | Sterimol/L: 17.246 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 601.609 | Positive charged surface: 435.126 | Negative charged surface: 166.482 | Volume: 297.5 |
Hydrophobic surface: 423.582 | Hydrophilic surface: 178.027 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |