 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CC[NH+](CC1)CCC[NH2+]C(CC(=O)Nc1cc(ccc1)C)C(=O)[O-] |
| InChI: | InChI=1/C18H27N3O4/c1-14-4-2-5-15(12-14)20-17(22)13-16(18(23)24)19-6-3-7-21-8-10-25-11-9-21/h2,4-5,12,16,19H,3,6-11,13H2,1H3,(H,20,22)(H,23,24)/p+1/t16-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=66.3963 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 350.439 g/mol | logS: -2.3084 | SlogP: -2.68928 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0666376 | Sterimol/B1: 2.48412 | Sterimol/B2: 2.93979 | Sterimol/B3: 4.9026 | |||
| Sterimol/B4: 9.83904 | Sterimol/L: 17.7555 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 658.786 | Positive charged surface: 475.684 | Negative charged surface: 183.102 | Volume: 350.375 | |||
| Hydrophobic surface: 487.508 | Hydrophilic surface: 171.278 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 2 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
