Type: Neutral
Formula: C15H23N3O5S2
SMILES: |
s1cccc1S(=O)(=O)N1CCCC1CNC(=O)C(=O)NCCCOC |
InChI: |
InChI=1/C15H23N3O5S2/c1-23-9-4-7-16-14(19)15(20)17-11-12-5-2-8-18(12)25(21,22)13-6-3-10-24-13/h3,6,10,12H,2,4-5,7-9,11H2,1H3,(H,16,19)(H,17,20)/t12-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 389.497 g/mol | logS: -2.50538 | SlogP: 0.1701 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0366848 | Sterimol/B1: 3.31614 | Sterimol/B2: 4.39733 | Sterimol/B3: 4.60088 |
Sterimol/B4: 5.75361 | Sterimol/L: 21.8608 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 659.731 | Positive charged surface: 436.571 | Negative charged surface: 223.161 | Volume: 344 |
Hydrophobic surface: 500.415 | Hydrophilic surface: 159.316 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |