Type: Neutral
Formula: C17H20N2O4S
SMILES: |
S(=O)(=O)(N1CCCC1CNC(=O)c1occc1)c1ccc(cc1)C |
InChI: |
InChI=1/C17H20N2O4S/c1-13-6-8-15(9-7-13)24(21,22)19-10-2-4-14(19)12-18-17(20)16-5-3-11-23-16/h3,5-9,11,14H,2,4,10,12H2,1H3,(H,18,20)/t14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 348.423 g/mol | logS: -4.01678 | SlogP: 2.17112 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.118334 | Sterimol/B1: 3.16173 | Sterimol/B2: 4.10015 | Sterimol/B3: 4.17399 |
Sterimol/B4: 5.48539 | Sterimol/L: 17.878 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 584.916 | Positive charged surface: 334.077 | Negative charged surface: 250.838 | Volume: 319.375 |
Hydrophobic surface: 496.086 | Hydrophilic surface: 88.83 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |