 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | o1cccc1C(N1CCOCC1)CNC(=O)C(=O)NCCc1c2c([nH]c1)cccc2 |
| InChI: | InChI=1/C22H26N4O4/c27-21(23-8-7-16-14-24-18-5-2-1-4-17(16)18)22(28)25-15-19(20-6-3-11-30-20)26-9-12-29-13-10-26/h1-6,11,14,19,24H,7-10,12-13,15H2,(H,23,27)(H,25,28)/t19-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=103.892 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 410.474 g/mol | logS: -3.76379 | SlogP: 1.70477 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0662873 | Sterimol/B1: 3.2666 | Sterimol/B2: 4.26123 | Sterimol/B3: 4.40135 | |||
| Sterimol/B4: 8.24115 | Sterimol/L: 18.2525 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 714.149 | Positive charged surface: 478.208 | Negative charged surface: 232.22 | Volume: 393.25 | |||
| Hydrophobic surface: 563.134 | Hydrophilic surface: 151.015 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
