 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | o1cccc1C([NH+]1CCOCC1)CNC(=O)C(=O)NCCc1c2c([nH]c1)cccc2 |
| InChI: | InChI=1/C22H26N4O4/c27-21(23-8-7-16-14-24-18-5-2-1-4-17(16)18)22(28)25-15-19(20-6-3-11-30-20)26-9-12-29-13-10-26/h1-6,11,14,19,24H,7-10,12-13,15H2,(H,23,27)(H,25,28)/p+1/t19-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=69.8972 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 411.482 g/mol | logS: -3.7394 | SlogP: 0.28767 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.036474 | Sterimol/B1: 3.11409 | Sterimol/B2: 3.4827 | Sterimol/B3: 3.89171 | |||
| Sterimol/B4: 6.89186 | Sterimol/L: 21.1016 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 710.397 | Positive charged surface: 491.988 | Negative charged surface: 214.126 | Volume: 398.25 | |||
| Hydrophobic surface: 558.133 | Hydrophilic surface: 152.264 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
