Type: Neutral
Formula: C17H24FN3O5S
SMILES: |
S(=O)(=O)(N1CCCOC1CNC(=O)C(=O)NC(C)C)c1ccc(F)cc1C |
InChI: |
InChI=1/C17H24FN3O5S/c1-11(2)20-17(23)16(22)19-10-15-21(7-4-8-26-15)27(24,25)14-6-5-13(18)9-12(14)3/h5-6,9,11,15H,4,7-8,10H2,1-3H3,(H,19,22)(H,20,23)/t15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 401.459 g/mol | logS: -3.12743 | SlogP: 0.51202 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0836318 | Sterimol/B1: 3.6365 | Sterimol/B2: 4.96452 | Sterimol/B3: 5.2802 |
Sterimol/B4: 6.22755 | Sterimol/L: 16.0828 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 614.167 | Positive charged surface: 388.805 | Negative charged surface: 225.362 | Volume: 349.625 |
Hydrophobic surface: 433.437 | Hydrophilic surface: 180.73 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |