 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(O)C([O-])C1n1c2N=CNC(=O)c2nc1Nc1ccc(cc1)C |
| InChI: | InChI=1/C17H18N5O5/c1-8-2-4-9(5-3-8)20-17-21-11-14(18-7-19-15(11)26)22(17)16-13(25)12(24)10(6-23)27-16/h2-5,7,10,12-13,16,23-24H,6H2,1H3,(H,20,21)(H,18,19,26)/q-1/t10-,12+,13-,16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=60.7474 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 372.361 g/mol | logS: -3.38223 | SlogP: 0.48352 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.029911 | Sterimol/B1: 2.80817 | Sterimol/B2: 3.3772 | Sterimol/B3: 5.36877 | |||
| Sterimol/B4: 6.72215 | Sterimol/L: 15.8195 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 577.668 | Positive charged surface: 366.448 | Negative charged surface: 211.22 | Volume: 324 | |||
| Hydrophobic surface: 358.013 | Hydrophilic surface: 219.655 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 1 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
