Type: Neutral
Formula: C16H21NO7
SMILES: |
O1C(CO)C(O)C(O)C(NC(=O)C)C1Oc1ccc(cc1)C(=O)C |
InChI: |
InChI=1/C16H21NO7/c1-8(19)10-3-5-11(6-4-10)23-16-13(17-9(2)20)15(22)14(21)12(7-18)24-16/h3-6,12-16,18,21-22H,7H2,1-2H3,(H,17,20)/t12-,13-,14+,15-,16+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 339.344 g/mol | logS: -1.49205 | SlogP: -0.7883 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.125432 | Sterimol/B1: 3.00373 | Sterimol/B2: 4.95662 | Sterimol/B3: 5.63035 |
Sterimol/B4: 6.20421 | Sterimol/L: 14.6806 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 578.52 | Positive charged surface: 378.63 | Negative charged surface: 199.89 | Volume: 302.875 |
Hydrophobic surface: 363.844 | Hydrophilic surface: 214.676 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |