 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(COC(=O)c2ccccc2)C(O)C([O-])C1n1c2N=CNC(=O)c2nc1 |
| InChI: | InChI=1/C17H15N4O6/c22-12-10(6-26-17(25)9-4-2-1-3-5-9)27-16(13(12)23)21-8-20-11-14(21)18-7-19-15(11)24/h1-5,7-8,10,12-13,16,22H,6H2,(H,18,19,24)/q-1/t10-,12+,13+,16-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=79.1612 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 371.329 g/mol | logS: -3.06486 | SlogP: 0.2962 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0610937 | Sterimol/B1: 2.60749 | Sterimol/B2: 2.92708 | Sterimol/B3: 4.2536 | |||
| Sterimol/B4: 8.20527 | Sterimol/L: 17.3825 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 596.246 | Positive charged surface: 356.668 | Negative charged surface: 239.578 | Volume: 316 | |||
| Hydrophobic surface: 350.585 | Hydrophilic surface: 245.661 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 1 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
