Type: Neutral
Formula: C22H29N3O3S
SMILES: |
s1cccc1CN(C(=O)C=1C=CC(=O)NC=1)C(CC)(C(=O)NC1CCCCC1)C |
InChI: |
InChI=1/C22H29N3O3S/c1-3-22(2,21(28)24-17-8-5-4-6-9-17)25(15-18-10-7-13-29-18)20(27)16-11-12-19(26)23-14-16/h7,10-14,17H,3-6,8-9,15H2,1-2H3,(H,23,26)(H,24,28)/t22-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 415.558 g/mol | logS: -4.84098 | SlogP: 3.5306 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.166563 | Sterimol/B1: 2.54781 | Sterimol/B2: 3.06343 | Sterimol/B3: 5.19186 |
Sterimol/B4: 7.76288 | Sterimol/L: 16.5638 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 588.835 | Positive charged surface: 355.296 | Negative charged surface: 233.538 | Volume: 386.375 |
Hydrophobic surface: 468.812 | Hydrophilic surface: 120.023 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |