Type: Neutral
Formula: C15H19F2N3O5S
SMILES: |
S(=O)(=O)(N1CCCOC1CNC(=O)C(=O)NCC)c1cc(F)ccc1F |
InChI: |
InChI=1/C15H19F2N3O5S/c1-2-18-14(21)15(22)19-9-13-20(6-3-7-25-13)26(23,24)12-8-10(16)4-5-11(12)17/h4-5,8,13H,2-3,6-7,9H2,1H3,(H,18,21)(H,19,22)/t13-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 391.395 g/mol | logS: -2.93473 | SlogP: -0.0458 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.129043 | Sterimol/B1: 3.45974 | Sterimol/B2: 4.04365 | Sterimol/B3: 4.32413 |
Sterimol/B4: 7.50498 | Sterimol/L: 15.6763 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 590.218 | Positive charged surface: 374.003 | Negative charged surface: 216.215 | Volume: 318.125 |
Hydrophobic surface: 449.394 | Hydrophilic surface: 140.824 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |