Type: Neutral
Formula: C17H26N2O3
SMILES: |
OC(=O)C(NCCCCCC)CC(=O)Nc1ccccc1C |
InChI: |
InChI=1/C17H26N2O3/c1-3-4-5-8-11-18-15(17(21)22)12-16(20)19-14-10-7-6-9-13(14)2/h6-7,9-10,15,18H,3-5,8,11-12H2,1-2H3,(H,19,20)(H,21,22)/t15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 306.406 g/mol | logS: -3.46678 | SlogP: 2.94672 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0649015 | Sterimol/B1: 3.35311 | Sterimol/B2: 3.36601 | Sterimol/B3: 4.58876 |
Sterimol/B4: 9.36341 | Sterimol/L: 17.2058 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 614.81 | Positive charged surface: 431.55 | Negative charged surface: 183.261 | Volume: 317.625 |
Hydrophobic surface: 473.991 | Hydrophilic surface: 140.819 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |