 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(N1CCCC1C(=O)[O-])c1c2c3c(ccc2)C(=O)N(c3cc1)CCCC |
| InChI: | InChI=1/C20H22N2O5S/c1-2-3-11-21-15-9-10-17(13-6-4-7-14(18(13)15)19(21)23)28(26,27)22-12-5-8-16(22)20(24)25/h4,6-7,9-10,16H,2-3,5,8,11-12H2,1H3,(H,24,25)/p-1/t16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=72.0018 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 401.463 g/mol | logS: -5.24769 | SlogP: 1.5031 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.127409 | Sterimol/B1: 3.08566 | Sterimol/B2: 3.08718 | Sterimol/B3: 5.98077 | |||
| Sterimol/B4: 8.05156 | Sterimol/L: 16.2084 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 607.984 | Positive charged surface: 353.72 | Negative charged surface: 247.133 | Volume: 357.125 | |||
| Hydrophobic surface: 420.661 | Hydrophilic surface: 187.323 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 0 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
