 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(C(CC)C)C(=O)[O-])CCCc1c2c([nH]c1)cccc2 |
| InChI: | InChI=1/C18H24N2O3/c1-3-12(2)17(18(22)23)20-16(21)10-6-7-13-11-19-15-9-5-4-8-14(13)15/h4-5,8-9,11-12,17,19H,3,6-7,10H2,1-2H3,(H,20,21)(H,22,23)/p-1/t12-,17-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=40.4939 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 315.393 g/mol | logS: -3.46833 | SlogP: 1.77137 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0558368 | Sterimol/B1: 3.10305 | Sterimol/B2: 3.744 | Sterimol/B3: 3.87534 | |||
| Sterimol/B4: 6.38046 | Sterimol/L: 17.8296 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 599.971 | Positive charged surface: 363.908 | Negative charged surface: 231.917 | Volume: 320.25 | |||
| Hydrophobic surface: 410.207 | Hydrophilic surface: 189.764 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 1 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
