 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(C(NC(=O)CCc1c2c([nH]c1)cccc2)C(=O)[O-])C |
| InChI: | InChI=1/C15H18N2O4/c1-9(18)14(15(20)21)17-13(19)7-6-10-8-16-12-5-3-2-4-11(10)12/h2-5,8-9,14,16,18H,6-7H2,1H3,(H,17,19)(H,20,21)/p-1/t9-,14-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=31.0841 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 289.311 g/mol | logS: -2.14526 | SlogP: -0.28403 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0520709 | Sterimol/B1: 2.79385 | Sterimol/B2: 3.02236 | Sterimol/B3: 4.24842 | |||
| Sterimol/B4: 5.96625 | Sterimol/L: 15.9309 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 531.64 | Positive charged surface: 304.871 | Negative charged surface: 221.627 | Volume: 272.125 | |||
| Hydrophobic surface: 325.381 | Hydrophilic surface: 206.259 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
