 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(C(C)C)C(=O)[O-])CCCc1c2c([nH]c1)cccc2 |
| InChI: | InChI=1/C17H22N2O3/c1-11(2)16(17(21)22)19-15(20)9-5-6-12-10-18-14-8-4-3-7-13(12)14/h3-4,7-8,10-11,16,18H,5-6,9H2,1-2H3,(H,19,20)(H,21,22)/p-1/t16-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=41.0104 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 301.366 g/mol | logS: -2.95311 | SlogP: 1.38127 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0425743 | Sterimol/B1: 2.87033 | Sterimol/B2: 2.91551 | Sterimol/B3: 3.52558 | |||
| Sterimol/B4: 6.50529 | Sterimol/L: 16.9766 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 580.717 | Positive charged surface: 352.544 | Negative charged surface: 223.257 | Volume: 301.375 | |||
| Hydrophobic surface: 387.261 | Hydrophilic surface: 193.456 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 1 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
