 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | SCC(NC(=O)CCCc1c2c([nH]c1)cccc2)C(=O)[O-] |
| InChI: | InChI=1/C15H18N2O3S/c18-14(17-13(9-21)15(19)20)7-3-4-10-8-16-12-6-2-1-5-11(10)12/h1-2,5-6,8,13,16,21H,3-4,7,9H2,(H,17,18)(H,19,20)/p-1/t13-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=34.0982 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 305.378 g/mol | logS: -3.21082 | SlogP: 0.65507 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0663224 | Sterimol/B1: 2.56378 | Sterimol/B2: 3.84306 | Sterimol/B3: 4.77255 | |||
| Sterimol/B4: 7.00971 | Sterimol/L: 16.4414 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 558.202 | Positive charged surface: 301.987 | Negative charged surface: 250.84 | Volume: 285.625 | |||
| Hydrophobic surface: 333.398 | Hydrophilic surface: 224.804 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 1 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
