 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)C1C2C(N=C(C)C1C(=O)Nc1ncccc1)=CC(CC2=O)C |
| InChI: | InChI=1/C23H23N3O3/c1-13-11-17-22(18(28)12-13)21(15-6-8-16(27)9-7-15)20(14(2)25-17)23(29)26-19-5-3-4-10-24-19/h3-11,13,20-22,27H,12H2,1-2H3,(H,24,26,29)/t13-,20+,21-,22-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=106.615 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 389.455 g/mol | logS: -3.40797 | SlogP: 3.7092 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.181677 | Sterimol/B1: 2.03676 | Sterimol/B2: 4.29171 | Sterimol/B3: 5.34148 | |||
| Sterimol/B4: 9.63129 | Sterimol/L: 16.165 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 629.109 | Positive charged surface: 402.844 | Negative charged surface: 226.265 | Volume: 369 | |||
| Hydrophobic surface: 465.011 | Hydrophilic surface: 164.098 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
