 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Fc1ccccc1C[NH+]1CCC2(O)C(CCCC2)C1c1ccccc1OC |
| InChI: | InChI=1/C23H28FNO2/c1-27-21-12-5-3-9-18(21)22-19-10-6-7-13-23(19,26)14-15-25(22)16-17-8-2-4-11-20(17)24/h2-5,8-9,11-12,19,22,26H,6-7,10,13-16H2,1H3/p+1/t19-,22-,23-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=57.3962 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 370.488 g/mol | logS: -4.83897 | SlogP: 3.6474 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.27247 | Sterimol/B1: 2.29011 | Sterimol/B2: 4.39118 | Sterimol/B3: 6.91095 | |||
| Sterimol/B4: 7.6788 | Sterimol/L: 14.6423 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 596.227 | Positive charged surface: 426.809 | Negative charged surface: 169.419 | Volume: 375.25 | |||
| Hydrophobic surface: 557.623 | Hydrophilic surface: 38.604 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
