 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1Nc2c(cc(cc2)C)C(C1[NH+]1CCCCC1)c1ccccc1 |
| InChI: | InChI=1/C21H24N2O/c1-15-10-11-18-17(14-15)19(16-8-4-2-5-9-16)20(21(24)22-18)23-12-6-3-7-13-23/h2,4-5,8-11,14,19-20H,3,6-7,12-13H2,1H3,(H,22,24)/p+1/t19-,20-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=73.4649 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 321.444 g/mol | logS: -4.51487 | SlogP: 2.51642 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.20447 | Sterimol/B1: 2.36242 | Sterimol/B2: 4.05482 | Sterimol/B3: 6.47408 | |||
| Sterimol/B4: 6.52399 | Sterimol/L: 15.1232 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 568.747 | Positive charged surface: 389.914 | Negative charged surface: 178.833 | Volume: 337.125 | |||
| Hydrophobic surface: 508.334 | Hydrophilic surface: 60.413 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
