Type: Neutral
Formula: C10H12FN3O7
SMILES: |
FC1=CN(C2OC(C(O)C(=O)N)C(O)C2O)C(=O)NC1=O |
InChI: |
InChI=1/C10H12FN3O7/c11-2-1-14(10(20)13-8(2)19)9-4(16)3(15)6(21-9)5(17)7(12)18/h1,3-6,9,15-17H,(H2,12,18)(H,13,19,20)/t3-,4+,5-,6+,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 305.218 g/mol | logS: -0.53945 | SlogP: -3.2491 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.15246 | Sterimol/B1: 3.15866 | Sterimol/B2: 3.45833 | Sterimol/B3: 3.6923 |
Sterimol/B4: 5.45018 | Sterimol/L: 12.8301 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 447.41 | Positive charged surface: 273.576 | Negative charged surface: 173.834 | Volume: 227.875 |
Hydrophobic surface: 144.275 | Hydrophilic surface: 303.135 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |