 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(=O)c1c2[nH]c3c(CCCC3C(=O)N)c2ccc1 |
| InChI: | InChI=1/C14H14N2O3/c15-13(17)9-5-1-3-7-8-4-2-6-10(14(18)19)12(8)16-11(7)9/h2,4,6,9,16H,1,3,5H2,(H2,15,17)(H,18,19)/t9-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=42.442 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 258.277 g/mol | logS: -2.88611 | SlogP: 1.77127 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0413014 | Sterimol/B1: 2.46573 | Sterimol/B2: 2.80836 | Sterimol/B3: 3.3628 | |||
| Sterimol/B4: 6.46782 | Sterimol/L: 12.0767 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 452.391 | Positive charged surface: 290.409 | Negative charged surface: 155.597 | Volume: 236 | |||
| Hydrophobic surface: 261.126 | Hydrophilic surface: 191.265 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
