 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(C(Cc2ccccc2)C(=O)NC(C(C)C)C(=O)[O-])C(=O)Nc2c1cccc2 |
| InChI: | InChI=1/C22H23N3O5/c1-13(2)18(21(28)29)24-19(26)17(12-14-8-4-3-5-9-14)25-20(27)15-10-6-7-11-16(15)23-22(25)30/h3-11,13,17-18H,12H2,1-2H3,(H,23,30)(H,24,26)(H,28,29)/p-1/t17-,18+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=55.0093 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 408.434 g/mol | logS: -4.82089 | SlogP: 1.17627 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.15009 | Sterimol/B1: 2.83956 | Sterimol/B2: 5.20938 | Sterimol/B3: 5.57677 | |||
| Sterimol/B4: 5.96873 | Sterimol/L: 15.8087 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 653.032 | Positive charged surface: 355.584 | Negative charged surface: 297.447 | Volume: 384.375 | |||
| Hydrophobic surface: 452.583 | Hydrophilic surface: 200.449 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
