 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(C(Cc2ccccc2)C(=O)NC(C(O)C)C(=O)[O-])C(=O)Nc2c1cccc2 |
| InChI: | InChI=1/C21H21N3O6/c1-12(25)17(20(28)29)23-18(26)16(11-13-7-3-2-4-8-13)24-19(27)14-9-5-6-10-15(14)22-21(24)30/h2-10,12,16-17,25H,11H2,1H3,(H,22,30)(H,23,26)(H,28,29)/p-1/t12-,16-,17-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=49.2329 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 410.406 g/mol | logS: -4.21481 | SlogP: -0.09893 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.144758 | Sterimol/B1: 3.3695 | Sterimol/B2: 4.04205 | Sterimol/B3: 4.51743 | |||
| Sterimol/B4: 8.61007 | Sterimol/L: 15.0599 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 644.167 | Positive charged surface: 345.704 | Negative charged surface: 298.462 | Volume: 370.25 | |||
| Hydrophobic surface: 435.372 | Hydrophilic surface: 208.795 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
