 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(C)c1ccccc1)/C(=C(/O)\NC(C)c1ccccc1)/CCCCC |
| InChI: | InChI=1/C24H32N2O2/c1-4-5-8-17-22(23(27)25-18(2)20-13-9-6-10-14-20)24(28)26-19(3)21-15-11-7-12-16-21/h6-7,9-16,18-19,25,27H,4-5,8,17H2,1-3H3,(H,26,28)/b23-22-/t18-,19-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=63.3975 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 380.532 g/mol | logS: -6.03396 | SlogP: 5.7555 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0766066 | Sterimol/B1: 2.21561 | Sterimol/B2: 3.98722 | Sterimol/B3: 4.03917 | |||
| Sterimol/B4: 10.3504 | Sterimol/L: 18.4638 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 714.1 | Positive charged surface: 448.443 | Negative charged surface: 265.657 | Volume: 406.5 | |||
| Hydrophobic surface: 601.35 | Hydrophilic surface: 112.75 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
