Type: Neutral
Formula: C21H22N4O2
SMILES: |
o1cccc1CNc1ncnc2c1oc1nc(c3CCCCc3c12)CCC |
InChI: |
InChI=1/C21H22N4O2/c1-2-6-16-14-8-3-4-9-15(14)17-18-19(27-21(17)25-16)20(24-12-23-18)22-11-13-7-5-10-26-13/h5,7,10,12H,2-4,6,8-9,11H2,1H3,(H,22,23,24) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 362.433 g/mol | logS: -7.27527 | SlogP: 5.07371 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.031894 | Sterimol/B1: 2.2674 | Sterimol/B2: 2.96708 | Sterimol/B3: 3.6902 |
Sterimol/B4: 9.7201 | Sterimol/L: 17.061 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 639.248 | Positive charged surface: 444.215 | Negative charged surface: 190.136 | Volume: 348.375 |
Hydrophobic surface: 482.655 | Hydrophilic surface: 156.593 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |