Type: Neutral
Formula: C13H24N6O2S
SMILES: |
s1cc(nc1N)C(CC(C)(C)C)(CCC(=O)NN)C(=O)NN |
InChI: |
InChI=1/C13H24N6O2S/c1-12(2,3)7-13(10(21)19-16,5-4-9(20)18-15)8-6-22-11(14)17-8/h6H,4-5,7,15-16H2,1-3H3,(H2,14,17)(H,18,20)(H,19,21)/t13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 328.441 g/mol | logS: -3.50296 | SlogP: 0.1593 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.265759 | Sterimol/B1: 3.88841 | Sterimol/B2: 4.24876 | Sterimol/B3: 5.52417 |
Sterimol/B4: 6.20589 | Sterimol/L: 14.2463 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 538.053 | Positive charged surface: 359.069 | Negative charged surface: 178.985 | Volume: 296.625 |
Hydrophobic surface: 206.356 | Hydrophilic surface: 331.697 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |