Type: Ionized
Formula: C8H15NO7P-
SMILES: |
P(O)(O)(=O)C(CCCCC([NH3+])C(=O)[O-])C(=O)[O-] |
InChI: |
InChI=1/C8H16NO7P/c9-5(7(10)11)3-1-2-4-6(8(12)13)17(14,15)16/h5-6H,1-4,9H2,(H,10,11)(H,12,13)(H2,14,15,16)/p-1/t5-,6-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 268.182 g/mol | logS: 0.09235 | SlogP: -4.8668 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0584683 | Sterimol/B1: 2.86325 | Sterimol/B2: 3.30043 | Sterimol/B3: 4.06363 |
Sterimol/B4: 4.18629 | Sterimol/L: 14.6925 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 456.902 | Positive charged surface: 255.639 | Negative charged surface: 201.263 | Volume: 216.125 |
Hydrophobic surface: 126.848 | Hydrophilic surface: 330.054 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 4 | Basic groups: 1 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|