 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(C(C(=O)NC(Cc2ccccc2)C(O)=O)C)C(=O)Nc2c1cccc2 |
| InChI: | InChI=1/C20H19N3O5/c1-12(23-18(25)14-9-5-6-10-15(14)22-20(23)28)17(24)21-16(19(26)27)11-13-7-3-2-4-8-13/h2-10,12,16H,11H2,1H3,(H,21,24)(H,22,28)(H,26,27)/t12-,16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=68.639 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 381.388 g/mol | logS: -4.1569 | SlogP: 1.87487 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.113862 | Sterimol/B1: 2.25496 | Sterimol/B2: 4.23706 | Sterimol/B3: 6.07995 | |||
| Sterimol/B4: 7.46903 | Sterimol/L: 15.43 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 613.872 | Positive charged surface: 345.371 | Negative charged surface: 268.501 | Volume: 343.25 | |||
| Hydrophobic surface: 419.272 | Hydrophilic surface: 194.6 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
