 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(C=Nc2c1cccc2)C(Cc1ccccc1)C(=O)NC(C(CC)C)C(=O)[O-] |
| InChI: | InChI=1/C23H25N3O4/c1-3-15(2)20(23(29)30)25-21(27)19(13-16-9-5-4-6-10-16)26-14-24-18-12-8-7-11-17(18)22(26)28/h4-12,14-15,19-20H,3,13H2,1-2H3,(H,25,27)(H,29,30)/p-1/t15-,19+,20+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=70.6561 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 406.462 g/mol | logS: -5.48594 | SlogP: 1.69427 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.140486 | Sterimol/B1: 3.8894 | Sterimol/B2: 4.05408 | Sterimol/B3: 4.10429 | |||
| Sterimol/B4: 8.59396 | Sterimol/L: 14.2553 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 671.314 | Positive charged surface: 371.951 | Negative charged surface: 299.363 | Volume: 392.875 | |||
| Hydrophobic surface: 500.307 | Hydrophilic surface: 171.007 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
