 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1Nc2c(cccc2)C12NC(C1C2C(=O)N(C1=O)c1ccccc1)CCC(=O)N |
| InChI: | InChI=1/C22H20N4O4/c23-16(27)11-10-15-17-18(20(29)26(19(17)28)12-6-2-1-3-7-12)22(25-15)13-8-4-5-9-14(13)24-21(22)30/h1-9,15,17-18,25H,10-11H2,(H2,23,27)(H,24,30)/t15-,17+,18-,22+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=112.102 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 404.426 g/mol | logS: -3.92695 | SlogP: 1.1886 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.249338 | Sterimol/B1: 2.22352 | Sterimol/B2: 3.4957 | Sterimol/B3: 5.06783 | |||
| Sterimol/B4: 11.1018 | Sterimol/L: 13.909 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 614.149 | Positive charged surface: 371.43 | Negative charged surface: 242.72 | Volume: 361.25 | |||
| Hydrophobic surface: 389.473 | Hydrophilic surface: 224.676 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.