 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1cc(ccc1Cl)CSc1nc2c(n1C1OC(CO)C(O)C1O)N=C(NC2=O)N |
| InChI: | InChI=1/C17H17Cl2N5O5S/c18-7-2-1-6(3-8(7)19)5-30-17-21-10-13(22-16(20)23-14(10)28)24(17)15-12(27)11(26)9(4-25)29-15/h1-3,9,11-12,15,25-27H,4-5H2,(H3,20,22,23,28)/t9-,11-,12-,15-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=81.3032 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 474.325 g/mol | logS: -5.52528 | SlogP: 1.1452 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.116563 | Sterimol/B1: 3.17134 | Sterimol/B2: 4.50992 | Sterimol/B3: 6.0185 | |||
| Sterimol/B4: 8.12128 | Sterimol/L: 18.2016 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 692.284 | Positive charged surface: 392.234 | Negative charged surface: 300.051 | Volume: 373.25 | |||
| Hydrophobic surface: 354.507 | Hydrophilic surface: 337.777 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
