Type: Neutral
Formula: C17H23NO4S
SMILES: |
S1CC(NC(=O)c2ccccc2)C(O)C1CCCCC(OC)=O |
InChI: |
InChI=1/C17H23NO4S/c1-22-15(19)10-6-5-9-14-16(20)13(11-23-14)18-17(21)12-7-3-2-4-8-12/h2-4,7-8,13-14,16,20H,5-6,9-11H2,1H3,(H,18,21)/t13-,14+,16+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 337.44 g/mol | logS: -3.36459 | SlogP: 1.9947 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0289854 | Sterimol/B1: 3.58677 | Sterimol/B2: 3.82234 | Sterimol/B3: 4.154 |
Sterimol/B4: 4.62735 | Sterimol/L: 21.8117 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 624.666 | Positive charged surface: 425.716 | Negative charged surface: 198.949 | Volume: 324.75 |
Hydrophobic surface: 474.283 | Hydrophilic surface: 150.383 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |