 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C2C(CC3C(C2)(CCCC3=C)C)C(C[NH+]2CC(N(CC2)c2cc(ccc2)C)C)C1= O |
| InChI: | InChI=1/C27H38N2O2/c1-18-7-5-9-21(13-18)29-12-11-28(16-20(29)3)17-23-22-14-24-19(2)8-6-10-27(24,4)15-25(22)31-26(23)30/h5,7,9,13,20,22-25H,2,6,8,10-12,14-17H2,1,3-4H3/p+1/t20-,22+,23-,24+,25-,27-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=130.345 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 423.621 g/mol | logS: -5.93336 | SlogP: 3.40262 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.05744 | Sterimol/B1: 3.03481 | Sterimol/B2: 3.8823 | Sterimol/B3: 4.42002 | |||
| Sterimol/B4: 6.01595 | Sterimol/L: 20.9906 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 720.976 | Positive charged surface: 527.343 | Negative charged surface: 193.632 | Volume: 447.5 | |||
| Hydrophobic surface: 591.808 | Hydrophilic surface: 129.168 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 0 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 6 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
