 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(CCC(NC(=O)C1=CC(=O)NC=C1)C(O)=O)C |
| InChI: | InChI=1/C11H14N2O4S/c1-18-5-3-8(11(16)17)13-10(15)7-2-4-12-9(14)6-7/h2,4,6,8H,3,5H2,1H3,(H,12,14)(H,13,15)(H,16,17)/t8-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=37.3022 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 270.309 g/mol | logS: -2.06199 | SlogP: -0.1212 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.100572 | Sterimol/B1: 2.07568 | Sterimol/B2: 3.11609 | Sterimol/B3: 3.88442 | |||
| Sterimol/B4: 8.9554 | Sterimol/L: 13.7564 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 490.883 | Positive charged surface: 265.076 | Negative charged surface: 225.807 | Volume: 238 | |||
| Hydrophobic surface: 252.436 | Hydrophilic surface: 238.447 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
