 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(OC1C(O)C(OC1N1C=CC(=O)NC1=O)CO)(=O)(=O)c1ccc(cc1)C |
| InChI: | InChI=1/C16H18N2O8S/c1-9-2-4-10(5-3-9)27(23,24)26-14-13(21)11(8-19)25-15(14)18-7-6-12(20)17-16(18)22/h2-7,11,13-15,19,21H,8H2,1H3,(H,17,20,22)/t11-,13+,14-,15-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=68.9788 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 398.392 g/mol | logS: -2.7377 | SlogP: -0.78748 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.108077 | Sterimol/B1: 3.02984 | Sterimol/B2: 4.39173 | Sterimol/B3: 5.68423 | |||
| Sterimol/B4: 5.91498 | Sterimol/L: 15.2575 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 544.404 | Positive charged surface: 315.057 | Negative charged surface: 229.348 | Volume: 320.375 | |||
| Hydrophobic surface: 324.091 | Hydrophilic surface: 220.313 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.