Type: Neutral
Formula: C15H17N5O2
SMILES: |
O=C1Nc2n(nc(n2)NC(=O)CCC)C(C1)c1ccccc1 |
InChI: |
InChI=1/C15H17N5O2/c1-2-6-12(21)16-14-18-15-17-13(22)9-11(20(15)19-14)10-7-4-3-5-8-10/h3-5,7-8,11H,2,6,9H2,1H3,(H2,16,17,18,19,21,22)/t11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 299.334 g/mol | logS: -4.00806 | SlogP: 2.0438 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0815199 | Sterimol/B1: 3.97582 | Sterimol/B2: 4.01628 | Sterimol/B3: 4.06253 |
Sterimol/B4: 5.53224 | Sterimol/L: 16.0769 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 545.652 | Positive charged surface: 349.121 | Negative charged surface: 196.531 | Volume: 280.125 |
Hydrophobic surface: 353.905 | Hydrophilic surface: 191.747 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |