Type: Neutral
Formula: C13H25NO6
SMILES: |
O1C(CO)C(O)C(O)C(NC(=O)C)C1OCCC(C)C |
InChI: |
InChI=1/C13H25NO6/c1-7(2)4-5-19-13-10(14-8(3)16)12(18)11(17)9(6-15)20-13/h7,9-13,15,17-18H,4-6H2,1-3H3,(H,14,16)/t9-,10-,11-,12-,13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 291.344 g/mol | logS: -1.03712 | SlogP: -1.0072 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0818387 | Sterimol/B1: 2.03333 | Sterimol/B2: 4.79415 | Sterimol/B3: 5.35937 |
Sterimol/B4: 7.53113 | Sterimol/L: 14.1758 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 555.333 | Positive charged surface: 406.756 | Negative charged surface: 148.577 | Volume: 280.625 |
Hydrophobic surface: 338.019 | Hydrophilic surface: 217.314 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |