Type: Neutral
Formula: C16H23NO6
SMILES: |
O1C(CO)C(O)C(O)C(NC(=O)C)C1OCCc1ccccc1 |
InChI: |
InChI=1/C16H23NO6/c1-10(19)17-13-15(21)14(20)12(9-18)23-16(13)22-8-7-11-5-3-2-4-6-11/h2-6,12-16,18,20-21H,7-9H2,1H3,(H,17,19)/t12-,13-,14-,15-,16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 325.361 g/mol | logS: -1.30707 | SlogP: -0.81063 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0659924 | Sterimol/B1: 2.15077 | Sterimol/B2: 3.28964 | Sterimol/B3: 3.55571 |
Sterimol/B4: 10.9179 | Sterimol/L: 15.4409 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 591.63 | Positive charged surface: 402.952 | Negative charged surface: 188.678 | Volume: 307 |
Hydrophobic surface: 418.026 | Hydrophilic surface: 173.604 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |