Type: Neutral
Formula: C16H19N3O4S
SMILES: |
S=C1NC(=O)C(C2OCc3c2c(O)c(nc3)C)C(=O)N1C(CC)C |
InChI: |
InChI=1/C16H19N3O4S/c1-4-7(2)19-15(22)11(14(21)18-16(19)24)13-10-9(6-23-13)5-17-8(3)12(10)20/h5,7,11,13,20H,4,6H2,1-3H3,(H,18,21,24)/t7-,11-,13+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 349.411 g/mol | logS: -3.01399 | SlogP: 1.68682 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.270412 | Sterimol/B1: 2.38994 | Sterimol/B2: 3.15028 | Sterimol/B3: 6.91644 |
Sterimol/B4: 6.95749 | Sterimol/L: 14.1334 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 522.985 | Positive charged surface: 319.405 | Negative charged surface: 203.58 | Volume: 306.125 |
Hydrophobic surface: 288.146 | Hydrophilic surface: 234.839 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |